C20H28N2O2 — CID 111630645
1-[cyclohexyl(phenyl)methyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 111630645) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[cyclohexyl(phenyl)methyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-[cyclohexyl(phenyl)methyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 111630645 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[cyclohexyl(phenyl)methyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | O=C(NC(c1ccccc1)C1CCCCC1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C20H28N2O2/c23-14-15-11-12-18(13-15)21-20(24)22-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1,3-4,7-8,11-12,15,17-19,23H,2,5-6,9-10,13-14H2,(H2,21,22,24)/t15-,18+,19?/m0/s1 |
| InChIKey | BGQZHNRDXBGVIB-APBAKZIRSA-N |
| XLogP | 3.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|