C21H24N2O2 — CID 111630345
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-phenylphenyl)ethyl]urea (PubChem CID 111630345) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-phenylphenyl)ethyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-phenylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 111630345 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-phenylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)N[C@@H]1C=C[C@H](CO)C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(22-21(25)23-20-12-7-16(13-20)14-24)17-8-10-19(11-9-17)18-5-3-2-4-6-18/h2-12,15-16,20,24H,13-14H2,1H3,(H2,22,23,25)/t15?,16-,20+/m0/s1 |
| InChIKey | JGLUXFUQQMTAFI-XGNAPRINSA-N |
| XLogP | 3.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|