C19H25NO3 — CID 111697096
2-cyclopentyloxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-phenylacetamide (PubChem CID 111697096) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyloxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 111697096 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-cyclopentyloxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-phenylacetamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)C(OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c21-13-14-10-11-16(12-14)20-19(22)18(15-6-2-1-3-7-15)23-17-8-4-5-9-17/h1-3,6-7,10-11,14,16-18,21H,4-5,8-9,12-13H2,(H,20,22)/t14-,16+,18?/m0/s1 |
| InChIKey | QDWKRBPVJUVPOL-QJZXMCBYSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|