C19H27NO3 — CID 111332884
2-cyclopentyloxy-N-[(1-hydroxycyclopentyl)methyl]-2-phenylacetamide (PubChem CID 111332884) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-[(1-hydroxycyclopentyl)methyl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyloxy-N-[(1-hydroxycyclopentyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 111332884 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 2-cyclopentyloxy-N-[(1-hydroxycyclopentyl)methyl]-2-phenylacetamide |
| SMILES | O=C(NCC1(O)CCCC1)C(OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c21-18(20-14-19(22)12-6-7-13-19)17(15-8-2-1-3-9-15)23-16-10-4-5-11-16/h1-3,8-9,16-17,22H,4-7,10-14H2,(H,20,21) |
| InChIKey | VTJXOOWGFSWFRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |