C19H24N2O3 — CID 111661791
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 111661791) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 111661791 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C19H24N2O3/c22-13-14-9-10-16(12-14)20-19(24)18(15-6-2-1-3-7-15)21-11-5-4-8-17(21)23/h1-3,6-7,9-10,14,16,18,22H,4-5,8,11-13H2,(H,20,24)/t14-,16+,18?/m0/s1 |
| InChIKey | KRMPBIAYWRSTMT-QJZXMCBYSA-N |
| XLogP | 1.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|