C19H28N2O3 — CID 111461259
N-(3-hydroxy-4-methylpentyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 111461259) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 111461259 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | CC(C)C(O)CCNC(=O)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C19H28N2O3/c1-14(2)16(22)11-12-20-19(24)18(15-8-4-3-5-9-15)21-13-7-6-10-17(21)23/h3-5,8-9,14,16,18,22H,6-7,10-13H2,1-2H3,(H,20,24) |
| InChIKey | CHWASSYGQLWLLQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |