C28H30N2O3 — CID 56577878
2-(2-oxopiperidin-1-yl)-2-phenyl-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide (PubChem CID 56577878) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 56577878 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc(COCc2ccccc2)cc1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C28H30N2O3/c31-26-13-7-8-18-30(26)27(25-11-5-2-6-12-25)28(32)29-19-22-14-16-24(17-15-22)21-33-20-23-9-3-1-4-10-23/h1-6,9-12,14-17,27H,7-8,13,18-21H2,(H,29,32) |
| InChIKey | RWEPNBCCTBTKKR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |