C25H24FN3O3 — CID 56505727
N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56505727) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56505727 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCc1ccc(Oc2cccc(F)c2)nc1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H24FN3O3/c26-20-9-6-10-21(15-20)32-22-13-12-18(16-27-22)17-28-25(31)24(19-7-2-1-3-8-19)29-14-5-4-11-23(29)30/h1-3,6-10,12-13,15-16,24H,4-5,11,14,17H2,(H,28,31) |
| InChIKey | AETZTCQTNJJHNA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |