C25H32N4O2 — CID 56514621
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56514621) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56514621 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H32N4O2/c30-23-12-6-9-17-29(23)24(21-10-4-3-5-11-21)25(31)27-19-20-13-14-22(26-18-20)28-15-7-1-2-8-16-28/h3-5,10-11,13-14,18,24H,1-2,6-9,12,15-17,19H2,(H,27,31) |
| InChIKey | KFAPMFLGQILGMZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |