C19H22FN3OS — CID 55745356
2-(2-fluorophenyl)sulfanyl-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide (PubChem CID 55745356) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 55745356 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)NCc1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C19H22FN3OS/c20-16-6-2-3-7-17(16)25-14-19(24)22-13-15-8-9-18(21-12-15)23-10-4-1-5-11-23/h2-3,6-9,12H,1,4-5,10-11,13-14H2,(H,22,24) |
| InChIKey | CELNFAWXCMSIBP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |