C20H25FN4OS — CID 55744485
N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 55744485) has the molecular formula C20H25FN4OS and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55744485 |
| Molecular Formula | C20H25FN4OS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | CCN1CCN(c2ccc(CNC(=O)CSc3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C20H25FN4OS/c1-2-24-9-11-25(12-10-24)19-8-7-16(13-22-19)14-23-20(26)15-27-18-6-4-3-5-17(18)21/h3-8,13H,2,9-12,14-15H2,1H3,(H,23,26) |
| InChIKey | XJRZNNPJOSENES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |