C17H22N2O2 — CID 56515214
N-(cyclopropylmethyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56515214) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56515214 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCC1CC1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C17H22N2O2/c20-15-8-4-5-11-19(15)16(14-6-2-1-3-7-14)17(21)18-12-13-9-10-13/h1-3,6-7,13,16H,4-5,8-12H2,(H,18,21) |
| InChIKey | OLVPOTISVVBMGO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |