C14H24N2O3 — CID 127785789
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(oxan-3-yl)ethyl]urea (PubChem CID 127785789) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(oxan-3-yl)ethyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(oxan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 127785789 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(oxan-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)N[C@@H]1C=C[C@H](CO)C1)C1CCCOC1 |
| InChI | InChI=1S/C14H24N2O3/c1-10(12-3-2-6-19-9-12)15-14(18)16-13-5-4-11(7-13)8-17/h4-5,10-13,17H,2-3,6-9H2,1H3,(H2,15,16,18)/t10?,11-,12?,13+/m0/s1 |
| InChIKey | IVZUUZWSTCFBOX-PYNQCMFNSA-N |
| XLogP | 1.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|