C17H22N2O3 — CID 111661232
N-[4-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-4-oxobutyl]benzamide (PubChem CID 111661232) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[4-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 111661232 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[4-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C17H22N2O3/c20-12-13-8-9-15(11-13)19-16(21)7-4-10-18-17(22)14-5-2-1-3-6-14/h1-3,5-6,8-9,13,15,20H,4,7,10-12H2,(H,18,22)(H,19,21)/t13-,15+/m0/s1 |
| InChIKey | VPUXUBHNBXXTQI-DZGCQCFKSA-N |
| XLogP | 1.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|