C21H30N2O3 — CID 167803950
N-[6-[(3-hydroxy-5,5-dimethylcyclohex-2-en-1-yl)amino]-6-oxohexyl]benzamide (PubChem CID 167803950) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[6-[(3-hydroxy-5,5-dimethylcyclohex-2-en-1-yl)amino]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[(3-hydroxy-5,5-dimethylcyclohex-2-en-1-yl)amino]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 167803950 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[6-[(3-hydroxy-5,5-dimethylcyclohex-2-en-1-yl)amino]-6-oxohexyl]benzamide |
| SMILES | CC1(C)CC(O)=CC(NC(=O)CCCCCNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-21(2)14-17(13-18(24)15-21)23-19(25)11-7-4-8-12-22-20(26)16-9-5-3-6-10-16/h3,5-6,9-10,13,17,24H,4,7-8,11-12,14-15H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | ORDLXCMQRWUOJE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|