C11H14BrNO — CID 81374930
2-bromo-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide (PubChem CID 81374930) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-bromo-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-bromo-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 81374930 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-bromo-N-[(1S)-1-(2-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1[C@H](C)NC(=O)CBr |
| InChI | InChI=1S/C11H14BrNO/c1-8-5-3-4-6-10(8)9(2)13-11(14)7-12/h3-6,9H,7H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | MNEAIPMACODSJQ-VIFPVBQESA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|