C13H17NO2 — CID 18071549
N-[1-(2-methylphenyl)ethyl]-3-oxobutanamide (PubChem CID 18071549) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[1-(2-methylphenyl)ethyl]-3-oxobutanamide.
| Compound Name | N-[1-(2-methylphenyl)ethyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 18071549 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[1-(2-methylphenyl)ethyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC(C)c1ccccc1C |
| InChI | InChI=1S/C13H17NO2/c1-9-6-4-5-7-12(9)11(3)14-13(16)8-10(2)15/h4-7,11H,8H2,1-3H3,(H,14,16) |
| InChIKey | CNUHOVNYAIUOOB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|