C17H18FNO — CID 18082306
2-(2-fluorophenyl)-N-[1-(2-methylphenyl)ethyl]acetamide (PubChem CID 18082306) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[1-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[1-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18082306 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[1-(2-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1C(C)NC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C17H18FNO/c1-12-7-3-5-9-15(12)13(2)19-17(20)11-14-8-4-6-10-16(14)18/h3-10,13H,11H2,1-2H3,(H,19,20) |
| InChIKey | LETHHCQZXLQHIY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |