C10H16N2O2S — CID 61043385
methyl 4-[(4-methyl-1,3-thiazol-2-yl)methylamino]butanoate (PubChem CID 61043385) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl 4-[(4-methyl-1,3-thiazol-2-yl)methylamino]butanoate.
| Compound Name | methyl 4-[(4-methyl-1,3-thiazol-2-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 61043385 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 4-[(4-methyl-1,3-thiazol-2-yl)methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1nc(C)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8-7-15-9(12-8)6-11-5-3-4-10(13)14-2/h7,11H,3-6H2,1-2H3 |
| InChIKey | OUYISZPWBCKHBJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|