C10H17BrN2S — CID 107320377
5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentan-1-amine (PubChem CID 107320377) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentan-1-amine.
| Compound Name | 5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 107320377 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentan-1-amine |
| SMILES | Cc1csc(CNCCCCCBr)n1 |
| InChI | InChI=1S/C10H17BrN2S/c1-9-8-14-10(13-9)7-12-6-4-2-3-5-11/h8,12H,2-7H2,1H3 |
| InChIKey | HURCAPLKNNEXMN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|