C11H18BrNS — CID 71350357
2-(7-bromoheptyl)-4-methyl-1,3-thiazole (PubChem CID 71350357) has the molecular formula C11H18BrNS and a molecular weight of 276.24 g/mol. Its IUPAC name is 2-(7-bromoheptyl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(7-bromoheptyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 71350357 |
| Molecular Formula | C11H18BrNS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(7-bromoheptyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(CCCCCCCBr)n1 |
| InChI | InChI=1S/C11H18BrNS/c1-10-9-14-11(13-10)7-5-3-2-4-6-8-12/h9H,2-8H2,1H3 |
| InChIKey | WVFKZFRDHAKQEK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|