C7H13NOS — CID 144707130
ethane;(4-methyl-1,3-thiazol-2-yl)methanol (PubChem CID 144707130) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is ethane;(4-methyl-1,3-thiazol-2-yl)methanol.
| Compound Name | ethane;(4-methyl-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 144707130 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | ethane;(4-methyl-1,3-thiazol-2-yl)methanol |
| SMILES | CC.Cc1csc(CO)n1 |
| InChI | InChI=1S/C5H7NOS.C2H6/c1-4-3-8-5(2-7)6-4;1-2/h3,7H,2H2,1H3;1-2H3 |
| InChIKey | WEDCEULPBOKRCO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |