C8H13NO2S — CID 103452784
1-(4-methyl-1,3-thiazol-2-yl)butane-2,3-diol (PubChem CID 103452784) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)butane-2,3-diol.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)butane-2,3-diol |
|---|---|
| PubChem CID | 103452784 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)butane-2,3-diol |
| SMILES | Cc1csc(CC(O)C(C)O)n1 |
| InChI | InChI=1S/C8H13NO2S/c1-5-4-12-8(9-5)3-7(11)6(2)10/h4,6-7,10-11H,3H2,1-2H3 |
| InChIKey | YUGOMBFBPPPCGY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |