C6H12N2S — CID 69058661
azane;2-ethyl-4-methyl-1,3-thiazole (PubChem CID 69058661) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is azane;2-ethyl-4-methyl-1,3-thiazole.
| Compound Name | azane;2-ethyl-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 69058661 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | azane;2-ethyl-4-methyl-1,3-thiazole |
| SMILES | CCc1nc(C)cs1.N |
| InChI | InChI=1S/C6H9NS.H3N/c1-3-6-7-5(2)4-8-6;/h4H,3H2,1-2H3;1H3 |
| InChIKey | CFYUXFFPTQHQPK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |