About (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium
(4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium (PubChem CID 7175910) has the molecular formula C8H15N2S+
and a molecular weight of 171.29 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium.
Analyze (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium?
The IUPAC name of (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium (CID 7175910) is (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium.
What is the SMILES notation for (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium?
The canonical SMILES for (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium is Cc1csc(C[NH2+]C(C)C)n1.
What is the InChIKey of (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium?
The InChIKey is BFIRMUXOKKNHBK-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14N2S/c1-6(2)9-4-8-10-7(3)5-11-8/h5-6,9H,4H2,1-3H3/p+1.
What are the key properties of (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium?
(4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium has a molecular weight of 171.29 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-thiazol-2-yl)methyl-propan-2-ylazanium is sourced from PubChem (CID 7175910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).