C6H9Cl2NS — CID 67878325
2-(2-chloroethyl)-4-methyl-1,3-thiazole;hydrochloride (PubChem CID 67878325) has the molecular formula C6H9Cl2NS and a molecular weight of 198.12 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-methyl-1,3-thiazole;hydrochloride.
| Compound Name | 2-(2-chloroethyl)-4-methyl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 67878325 |
| Molecular Formula | C6H9Cl2NS |
| Molecular Weight | 198.12 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 2-(2-chloroethyl)-4-methyl-1,3-thiazole;hydrochloride |
| SMILES | Cc1csc(CCCl)n1.Cl |
| InChI | InChI=1S/C6H8ClNS.ClH/c1-5-4-9-6(8-5)2-3-7;/h4H,2-3H2,1H3;1H |
| InChIKey | NICUAYXPSJSKCC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|