C8H12N2O2S — CID 82103146
2-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]acetic acid (PubChem CID 82103146) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]acetic acid.
| Compound Name | 2-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]acetic acid |
|---|---|
| PubChem CID | 82103146 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]acetic acid |
| SMILES | Cc1csc(CCNCC(=O)O)n1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6-5-13-7(10-6)2-3-9-4-8(11)12/h5,9H,2-4H2,1H3,(H,11,12) |
| InChIKey | WBVKQGRRRZGEPJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|