C12H23N3S — CID 112555997
3,3-dimethyl-1-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]butane-1,2-diamine (PubChem CID 112555997) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]butane-1,2-diamine.
| Compound Name | 3,3-dimethyl-1-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 112555997 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3,3-dimethyl-1-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]butane-1,2-diamine |
| SMILES | Cc1csc(CCNCC(N)C(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N3S/c1-9-8-16-11(15-9)5-6-14-7-10(13)12(2,3)4/h8,10,14H,5-7,13H2,1-4H3 |
| InChIKey | PVHGDSFTNHOJQA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|