C8H13N3OS — CID 115579398
1-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea (PubChem CID 115579398) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 115579398 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea |
| SMILES | CNC(=O)NCCc1nc(C)cs1 |
| InChI | InChI=1S/C8H13N3OS/c1-6-5-13-7(11-6)3-4-10-8(12)9-2/h5H,3-4H2,1-2H3,(H2,9,10,12) |
| InChIKey | PYCYMXSIYGHBDQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |