C13H21N3OS — CID 39072001
1-cyclohexyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea (PubChem CID 39072001) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 39072001 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-cyclohexyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]urea |
| SMILES | Cc1csc(CCNC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-10-9-18-12(15-10)7-8-14-13(17)16-11-5-3-2-4-6-11/h9,11H,2-8H2,1H3,(H2,14,16,17) |
| InChIKey | PJCUBSKWPPDSSB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |