C15H25N3OS2 — CID 71990317
1-(3-methylsulfanylcyclopentyl)-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]urea (PubChem CID 71990317) has the molecular formula C15H25N3OS2 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-(3-methylsulfanylcyclopentyl)-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]urea.
| Compound Name | 1-(3-methylsulfanylcyclopentyl)-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]urea |
|---|---|
| PubChem CID | 71990317 |
| Molecular Formula | C15H25N3OS2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(3-methylsulfanylcyclopentyl)-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]urea |
| SMILES | CSC1CCC(NC(=O)NCCCCc2nc(C)cs2)C1 |
| InChI | InChI=1S/C15H25N3OS2/c1-11-10-21-14(17-11)5-3-4-8-16-15(19)18-12-6-7-13(9-12)20-2/h10,12-13H,3-9H2,1-2H3,(H2,16,18,19) |
| InChIKey | DCKMAIQUEOZLCQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|