C14H25Cl2N3OS — CID 119875284
N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119875284) has the molecular formula C14H25Cl2N3OS and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119875284 |
| Molecular Formula | C14H25Cl2N3OS |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cc1csc(CCCCNC(=O)C2CCCNC2)n1.Cl.Cl |
| InChI | InChI=1S/C14H23N3OS.2ClH/c1-11-10-19-13(17-11)6-2-3-8-16-14(18)12-5-4-7-15-9-12;;/h10,12,15H,2-9H2,1H3,(H,16,18);2*1H |
| InChIKey | QQKVBKBVXNYPAJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|