C18H27N3O2S — CID 97141950
(3S)-1-cyclopentyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-oxopiperidine-3-carboxamide (PubChem CID 97141950) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (3S)-1-cyclopentyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-1-cyclopentyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97141950 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3S)-1-cyclopentyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@H]2CCC(=O)N(C3CCCC3)C2)n1 |
| InChI | InChI=1S/C18H27N3O2S/c1-13-12-24-16(20-13)7-4-10-19-18(23)14-8-9-17(22)21(11-14)15-5-2-3-6-15/h12,14-15H,2-11H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | UDEARLOZNKQKQX-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|