C12H18N2O2S — CID 124527551
(3S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]oxolane-3-carboxamide (PubChem CID 124527551) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (3S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 124527551 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (3S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]oxolane-3-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@H]2CCOC2)n1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-8-17-11(14-9)3-2-5-13-12(15)10-4-6-16-7-10/h8,10H,2-7H2,1H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | DTABBWBWBFYHRA-JTQLQIEISA-N |
| XLogP | 1.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|