C14H21N3O2S2 — CID 125178511
(3S)-6,6-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-oxothiomorpholine-3-carboxamide (PubChem CID 125178511) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is (3S)-6,6-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-oxothiomorpholine-3-carboxamide.
| Compound Name | (3S)-6,6-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 125178511 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (3S)-6,6-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-oxothiomorpholine-3-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@H]2CSC(C)(C)C(=O)N2)n1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-9-7-20-11(16-9)5-4-6-15-12(18)10-8-21-14(2,3)13(19)17-10/h7,10H,4-6,8H2,1-3H3,(H,15,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | VWIQWCCDXVRDKN-SNVBAGLBSA-N |
| XLogP | 1.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|