C13H18N2O3S — CID 125119577
trans-(1R,2R)-2-[4-(4-methyl-1,3-thiazol-2-yl)butylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 125119577) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is trans-(1R,2R)-2-[4-(4-methyl-1,3-thiazol-2-yl)butylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[4-(4-methyl-1,3-thiazol-2-yl)butylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 125119577 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | trans-(1R,2R)-2-[4-(4-methyl-1,3-thiazol-2-yl)butylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1csc(CCCCNC(=O)[C@@H]2C[C@H]2C(=O)O)n1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8-7-19-11(15-8)4-2-3-5-14-12(16)9-6-10(9)13(17)18/h7,9-10H,2-6H2,1H3,(H,14,16)(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | CGBHNUGWINWALS-NXEZZACHSA-N |
| XLogP | 1.61 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|