C15H26ClN3OS — CID 120635411
(2S,4S)-2-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120635411) has the molecular formula C15H26ClN3OS and a molecular weight of 331.91 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-2-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120635411 |
| Molecular Formula | C15H26ClN3OS |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2S,4S)-2-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1csc(CCCCNC(=O)[C@H]2CCN[C@@H](C)C2)n1.Cl |
| InChI | InChI=1S/C15H25N3OS.ClH/c1-11-9-13(6-8-16-11)15(19)17-7-4-3-5-14-18-12(2)10-20-14;/h10-11,13,16H,3-9H2,1-2H3,(H,17,19);1H/t11-,13-;/m0./s1 |
| InChIKey | JJMOFDDMAQSWFD-JZKFLRDJSA-N |
| XLogP | 2.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|