C14H22N4O2S — CID 97113726
(3S)-3-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1,3-dicarboxamide (PubChem CID 97113726) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (3S)-3-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97113726 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3S)-3-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@H]2CCCN(C(N)=O)C2)n1 |
| InChI | InChI=1S/C14H22N4O2S/c1-10-9-21-12(17-10)5-2-6-16-13(19)11-4-3-7-18(8-11)14(15)20/h9,11H,2-8H2,1H3,(H2,15,20)(H,16,19)/t11-/m0/s1 |
| InChIKey | GGDPLOQGVYYGBY-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|