C18H30N6O2 — CID 97112978
(3R)-3-N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]piperidine-1,3-dicarboxamide (PubChem CID 97112978) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (3R)-3-N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97112978 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (3R)-3-N-[2-[(2-butyl-6-methylpyrimidin-4-yl)amino]ethyl]piperidine-1,3-dicarboxamide |
| SMILES | CCCCc1nc(C)cc(NCCNC(=O)[C@@H]2CCCN(C(N)=O)C2)n1 |
| InChI | InChI=1S/C18H30N6O2/c1-3-4-7-15-22-13(2)11-16(23-15)20-8-9-21-17(25)14-6-5-10-24(12-14)18(19)26/h11,14H,3-10,12H2,1-2H3,(H2,19,26)(H,21,25)(H,20,22,23)/t14-/m1/s1 |
| InChIKey | ZMXPOYAPNSEKKR-CQSZACIVSA-N |
| XLogP | 1.45 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|