C18H28N4O4S — CID 49407718
N-butyl-1-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]piperidine-3-carboxamide (PubChem CID 49407718) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-butyl-1-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49407718 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-butyl-1-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(C(=O)CSCC(=O)Nc2cc(C)on2)C1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-4-7-19-18(25)14-6-5-8-22(10-14)17(24)12-27-11-16(23)20-15-9-13(2)26-21-15/h9,14H,3-8,10-12H2,1-2H3,(H,19,25)(H,20,21,23) |
| InChIKey | SFQKPSHDMBYJML-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|