C10H16N2OS — CID 63335162
N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxolan-3-amine (PubChem CID 63335162) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxolan-3-amine.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 63335162 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxolan-3-amine |
| SMILES | Cc1csc(CCNC2CCOC2)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-7-14-10(12-8)2-4-11-9-3-5-13-6-9/h7,9,11H,2-6H2,1H3 |
| InChIKey | GNPQYBCLPKFNTD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |