C10H16N2S2 — CID 63238611
N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]thiolan-3-amine (PubChem CID 63238611) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]thiolan-3-amine.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 63238611 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]thiolan-3-amine |
| SMILES | Cc1csc(CCNC2CCSC2)n1 |
| InChI | InChI=1S/C10H16N2S2/c1-8-6-14-10(12-8)2-4-11-9-3-5-13-7-9/h6,9,11H,2-5,7H2,1H3 |
| InChIKey | FJLUBBCXWROVEQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |