C12H20N2S2 — CID 115716272
N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine (PubChem CID 115716272) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine.
| Compound Name | N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 115716272 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
| SMILES | CC(C)c1nc(CCNC2CCSC2)cs1 |
| InChI | InChI=1S/C12H20N2S2/c1-9(2)12-14-11(8-16-12)3-5-13-10-4-6-15-7-10/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | BMQQFXDWTYXXQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |