C13H25ClN2S — CID 115607884
2,2-dimethyl-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]propan-1-amine;hydrochloride (PubChem CID 115607884) has the molecular formula C13H25ClN2S and a molecular weight of 276.88 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]propan-1-amine;hydrochloride.
| Compound Name | 2,2-dimethyl-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115607884 |
| Molecular Formula | C13H25ClN2S |
| Molecular Weight | 276.88 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,2-dimethyl-N-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]propan-1-amine;hydrochloride |
| SMILES | CC(C)c1nc(CCNCC(C)(C)C)cs1.Cl |
| InChI | InChI=1S/C13H24N2S.ClH/c1-10(2)12-15-11(8-16-12)6-7-14-9-13(3,4)5;/h8,10,14H,6-7,9H2,1-5H3;1H |
| InChIKey | RAXAPUIXNFKLKY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|