C16H18N2O2S — CID 124758437
(3S)-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide (PubChem CID 124758437) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is (3S)-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 124758437 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (3S)-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)cs1)[C@H]1CCOC1 |
| InChI | InChI=1S/C16H18N2O2S/c19-16(13-7-9-20-10-13)17-8-6-15-18-14(11-21-15)12-4-2-1-3-5-12/h1-5,11,13H,6-10H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | YPMRIWAVJIAYLB-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |