C16H15N3OS — CID 127045820
N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pyrrole-1-carboxamide (PubChem CID 127045820) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pyrrole-1-carboxamide.
| Compound Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 127045820 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pyrrole-1-carboxamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)cs1)n1cccc1 |
| InChI | InChI=1S/C16H15N3OS/c20-16(19-10-4-5-11-19)17-9-8-15-18-14(12-21-15)13-6-2-1-3-7-13/h1-7,10-12H,8-9H2,(H,17,20) |
| InChIKey | XBAVNLNWXQJWKI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |