C17H22N4OS — CID 119875478
N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]piperidine-3-carboxamide (PubChem CID 119875478) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119875478 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1nc(-c2ccncc2)cs1)C1CCCNC1 |
| InChI | InChI=1S/C17H22N4OS/c22-17(14-3-1-7-19-11-14)20-8-2-4-16-21-15(12-23-16)13-5-9-18-10-6-13/h5-6,9-10,12,14,19H,1-4,7-8,11H2,(H,20,22) |
| InChIKey | WNILANYIFGKTNZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|