C20H26FN3OS — CID 166292580
cis-(1S,3R)-3-(fluoromethyl)-N-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butyl]cyclohexane-1-carboxamide (PubChem CID 166292580) has the molecular formula C20H26FN3OS and a molecular weight of 375.51 g/mol. Its IUPAC name is cis-(1S,3R)-3-(fluoromethyl)-N-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-(fluoromethyl)-N-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166292580 |
| Molecular Formula | C20H26FN3OS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | cis-(1S,3R)-3-(fluoromethyl)-N-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCCCCc1nc(-c2cccnc2)cs1)[C@H]1CCC[C@@H](CF)C1 |
| InChI | InChI=1S/C20H26FN3OS/c21-12-15-5-3-6-16(11-15)20(25)23-10-2-1-8-19-24-18(14-26-19)17-7-4-9-22-13-17/h4,7,9,13-16H,1-3,5-6,8,10-12H2,(H,23,25)/t15-,16+/m1/s1 |
| InChIKey | WOPOMFALZLZLQC-CVEARBPZSA-N |
| XLogP | 4.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|