C12H14N2OS — CID 116968662
4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butan-1-ol (PubChem CID 116968662) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butan-1-ol.
| Compound Name | 4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 116968662 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(4-pyridin-3-yl-1,3-thiazol-2-yl)butan-1-ol |
| SMILES | OCCCCc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C12H14N2OS/c15-7-2-1-5-12-14-11(9-16-12)10-4-3-6-13-8-10/h3-4,6,8-9,15H,1-2,5,7H2 |
| InChIKey | SQRZOZAPWNRZDJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|