C14H19N3OS — CID 82103016
2-[2-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethylamino]butan-1-ol (PubChem CID 82103016) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[2-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethylamino]butan-1-ol.
| Compound Name | 2-[2-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 82103016 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[2-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethylamino]butan-1-ol |
| SMILES | CCC(CO)NCCc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C14H19N3OS/c1-2-12(9-18)16-7-5-14-17-13(10-19-14)11-4-3-6-15-8-11/h3-4,6,8,10,12,16,18H,2,5,7,9H2,1H3 |
| InChIKey | ZGSPLQKHVWUJTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |